About (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate
(3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate (PubChem CID 11696362) has the molecular formula C21H23NOS2
and a molecular weight of 369.56 g/mol. Its IUPAC name is (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate.
Molecular Properties
| Compound Name | (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate |
| PubChem CID | 11696362 |
| Molecular Formula | C21H23NOS2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate |
| SMILES | O=C(CC(SC(=S)N1CCCCC1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NOS2/c23-19(17-10-4-1-5-11-17)16-20(18-12-6-2-7-13-18)25-21(24)22-14-8-3-9-15-22/h1-2,4-7,10-13,20H,3,8-9,14-16H2 |
| InChIKey | VQSNAROJLAMYOE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate?
The IUPAC name of (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate (CID 11696362) is (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate.
What is the SMILES notation for (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate?
The canonical SMILES for (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate is O=C(CC(SC(=S)N1CCCCC1)c1ccccc1)c1ccccc1.
What is the InChIKey of (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate?
The InChIKey is VQSNAROJLAMYOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NOS2/c23-19(17-10-4-1-5-11-17)16-20(18-12-6-2-7-13-18)25-21(24)22-14-8-3-9-15-22/h1-2,4-7,10-13,20H,3,8-9,14-16H2.
What are the key properties of (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate?
(3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate has a molecular weight of 369.56 g/mol, XLogP of 5.50, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-1,3-diphenylpropyl) piperidine-1-carbodithioate is sourced from PubChem (CID 11696362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).