About [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol
[1-(2,4,6-trimethylphenyl)cyclobutyl]methanol (PubChem CID 116963739) has the molecular formula C14H20O
and a molecular weight of 204.31 g/mol. Its IUPAC name is [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol.
Molecular Properties
| Compound Name | [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol |
| PubChem CID | 116963739 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol |
| SMILES | Cc1cc(C)c(C2(CO)CCC2)c(C)c1 |
| InChI | InChI=1S/C14H20O/c1-10-7-11(2)13(12(3)8-10)14(9-15)5-4-6-14/h7-8,15H,4-6,9H2,1-3H3 |
| InChIKey | VRGLVMOJDMPFKI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol?
The IUPAC name of [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol (CID 116963739) is [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol.
What is the SMILES notation for [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol?
The canonical SMILES for [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol is Cc1cc(C)c(C2(CO)CCC2)c(C)c1.
What is the InChIKey of [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol?
The InChIKey is VRGLVMOJDMPFKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O/c1-10-7-11(2)13(12(3)8-10)14(9-15)5-4-6-14/h7-8,15H,4-6,9H2,1-3H3.
What are the key properties of [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol?
[1-(2,4,6-trimethylphenyl)cyclobutyl]methanol has a molecular weight of 204.31 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,4,6-trimethylphenyl)cyclobutyl]methanol is sourced from PubChem (CID 116963739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).