C13H14O2 — CID 116963820
[1-(1-benzofuran-3-yl)cyclobutyl]methanol (PubChem CID 116963820) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is [1-(1-benzofuran-3-yl)cyclobutyl]methanol.
| Compound Name | [1-(1-benzofuran-3-yl)cyclobutyl]methanol |
|---|---|
| PubChem CID | 116963820 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | [1-(1-benzofuran-3-yl)cyclobutyl]methanol |
| SMILES | OCC1(c2coc3ccccc23)CCC1 |
| InChI | InChI=1S/C13H14O2/c14-9-13(6-3-7-13)11-8-15-12-5-2-1-4-10(11)12/h1-2,4-5,8,14H,3,6-7,9H2 |
| InChIKey | CCAAOGJZVCNURM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |