About 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one
4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one (PubChem CID 116966086) has the molecular formula C7H6N2OS
and a molecular weight of 166.20 g/mol. Its IUPAC name is 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one |
| PubChem CID | 116966086 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(-c2cc[nH]c2)cs1 |
| InChI | InChI=1S/C7H6N2OS/c10-7-9-6(4-11-7)5-1-2-8-3-5/h1-4,8H,(H,9,10) |
| InChIKey | IQRHTPDIWZIFLL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one?
The IUPAC name of 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one (CID 116966086) is 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one is O=c1[nH]c(-c2cc[nH]c2)cs1.
What is the InChIKey of 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one?
The InChIKey is IQRHTPDIWZIFLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS/c10-7-9-6(4-11-7)5-1-2-8-3-5/h1-4,8H,(H,9,10).
What are the key properties of 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one?
4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one has a molecular weight of 166.20 g/mol, XLogP of 1.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-pyrrol-3-yl)-3H-1,3-thiazol-2-one is sourced from PubChem (CID 116966086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).