About 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one
4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one (PubChem CID 116966108) has the molecular formula C10H6N2O2S
and a molecular weight of 218.24 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one |
| PubChem CID | 116966108 |
| Molecular Formula | C10H6N2O2S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(-c2ccc3ncoc3c2)cs1 |
| InChI | InChI=1S/C10H6N2O2S/c13-10-12-8(4-15-10)6-1-2-7-9(3-6)14-5-11-7/h1-5H,(H,12,13) |
| InChIKey | UDXFZFNZFSRWPG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one?
The IUPAC name of 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one (CID 116966108) is 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one is O=c1[nH]c(-c2ccc3ncoc3c2)cs1.
What is the InChIKey of 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one?
The InChIKey is UDXFZFNZFSRWPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O2S/c13-10-12-8(4-15-10)6-1-2-7-9(3-6)14-5-11-7/h1-5H,(H,12,13).
What are the key properties of 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one?
4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one has a molecular weight of 218.24 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-6-yl)-3H-1,3-thiazol-2-one is sourced from PubChem (CID 116966108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).