C14H15NO2S — CID 116967222
3-methyl-2-(4-phenyl-1,3-thiazol-2-yl)butanoic acid (PubChem CID 116967222) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-methyl-2-(4-phenyl-1,3-thiazol-2-yl)butanoic acid.
| Compound Name | 3-methyl-2-(4-phenyl-1,3-thiazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 116967222 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 3-methyl-2-(4-phenyl-1,3-thiazol-2-yl)butanoic acid |
| SMILES | CC(C)C(C(=O)O)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C14H15NO2S/c1-9(2)12(14(16)17)13-15-11(8-18-13)10-6-4-3-5-7-10/h3-9,12H,1-2H3,(H,16,17) |
| InChIKey | MPZVZDANNRTFHC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |