About 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one
8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 11696788) has the molecular formula C23H26N4O2
and a molecular weight of 390.49 g/mol. Its IUPAC name is 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one |
| PubChem CID | 11696788 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2c(cccc2N2CCN(CCCc3c[nH]c4ccccc34)CC2)N1 |
| InChI | InChI=1S/C23H26N4O2/c28-22-16-29-23-20(25-22)8-3-9-21(23)27-13-11-26(12-14-27)10-4-5-17-15-24-19-7-2-1-6-18(17)19/h1-3,6-9,15,24H,4-5,10-14,16H2,(H,25,28) |
| InChIKey | MKNKEMCPBIDCMA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one?
The IUPAC name of 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one (CID 11696788) is 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one is O=C1COc2c(cccc2N2CCN(CCCc3c[nH]c4ccccc34)CC2)N1.
What is the InChIKey of 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one?
The InChIKey is MKNKEMCPBIDCMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O2/c28-22-16-29-23-20(25-22)8-3-9-21(23)27-13-11-26(12-14-27)10-4-5-17-15-24-19-7-2-1-6-18(17)19/h1-3,6-9,15,24H,4-5,10-14,16H2,(H,25,28).
What are the key properties of 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one?
8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one has a molecular weight of 390.49 g/mol, XLogP of 3.25, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-[3-(1H-indol-3-yl)propyl]piperazin-1-yl]-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 11696788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).