C12H12ClNOS — CID 116968103
2-chloro-4-(2-methoxy-3,5-dimethylphenyl)-1,3-thiazole (PubChem CID 116968103) has the molecular formula C12H12ClNOS and a molecular weight of 253.75 g/mol. Its IUPAC name is 2-chloro-4-(2-methoxy-3,5-dimethylphenyl)-1,3-thiazole.
| Compound Name | 2-chloro-4-(2-methoxy-3,5-dimethylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116968103 |
| Molecular Formula | C12H12ClNOS |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-chloro-4-(2-methoxy-3,5-dimethylphenyl)-1,3-thiazole |
| SMILES | COc1c(C)cc(C)cc1-c1csc(Cl)n1 |
| InChI | InChI=1S/C12H12ClNOS/c1-7-4-8(2)11(15-3)9(5-7)10-6-16-12(13)14-10/h4-6H,1-3H3 |
| InChIKey | SBTBQOUSAXSVSB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |