C11H19N7O7S — CID 11696844
[(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a-methyl-3,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methoxycarbonylsulfamic acid (PubChem CID 11696844) has the molecular formula C11H19N7O7S and a molecular weight of 393.38 g/mol. Its IUPAC name is [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a-methyl-3,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methoxycarbonylsulfamic acid.
| Compound Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a-methyl-3,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methoxycarbonylsulfamic acid |
|---|---|
| PubChem CID | 11696844 |
| Molecular Formula | C11H19N7O7S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a-methyl-3,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methoxycarbonylsulfamic acid |
| SMILES | C[C@@]12NC(N)=N[C@]13N(CCC3(O)O)C(N)=N[C@H]2COC(=O)NS(=O)(=O)O |
| InChI | InChI=1S/C11H19N7O7S/c1-9-5(4-25-8(19)17-26(22,23)24)14-7(13)18-3-2-10(20,21)11(9,18)16-6(12)15-9/h5,20-21H,2-4H2,1H3,(H2,13,14)(H,17,19)(H3,12,15,16)(H,22,23,24)/t5-,9-,11-/m0/s1 |
| InChIKey | GRFGXSVWUFIAPT-WCHZAOPHSA-N |
| XLogP | -4.03 |
| TPSA | 225.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|