About 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine
6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine (PubChem CID 11696910) has the molecular formula C17H16Cl3N5
and a molecular weight of 396.71 g/mol. Its IUPAC name is 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine |
| PubChem CID | 11696910 |
| Molecular Formula | C17H16Cl3N5 |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine |
| SMILES | Clc1ccc2nc(CN3CCN(c4ccc(Cl)c(Cl)c4)CC3)cn2n1 |
| InChI | InChI=1S/C17H16Cl3N5/c18-14-2-1-13(9-15(14)19)24-7-5-23(6-8-24)10-12-11-25-17(21-12)4-3-16(20)22-25/h1-4,9,11H,5-8,10H2 |
| InChIKey | YJBGSZUYOGPUMC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine?
The IUPAC name of 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine (CID 11696910) is 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine.
What is the SMILES notation for 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine?
The canonical SMILES for 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine is Clc1ccc2nc(CN3CCN(c4ccc(Cl)c(Cl)c4)CC3)cn2n1.
What is the InChIKey of 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine?
The InChIKey is YJBGSZUYOGPUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl3N5/c18-14-2-1-13(9-15(14)19)24-7-5-23(6-8-24)10-12-11-25-17(21-12)4-3-16(20)22-25/h1-4,9,11H,5-8,10H2.
What are the key properties of 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine?
6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine has a molecular weight of 396.71 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]imidazo[1,2-b]pyridazine is sourced from PubChem (CID 11696910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).