About 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol
4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol (PubChem CID 116969164) has the molecular formula C14H18N2OS
and a molecular weight of 262.38 g/mol. Its IUPAC name is 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol |
| PubChem CID | 116969164 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol |
| SMILES | OC1CCC(Cc2nc(-c3cc[nH]c3)cs2)CC1 |
| InChI | InChI=1S/C14H18N2OS/c17-12-3-1-10(2-4-12)7-14-16-13(9-18-14)11-5-6-15-8-11/h5-6,8-10,12,15,17H,1-4,7H2 |
| InChIKey | XKSLPXUUIGIIKH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol?
The IUPAC name of 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol (CID 116969164) is 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol.
What is the SMILES notation for 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol?
The canonical SMILES for 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol is OC1CCC(Cc2nc(-c3cc[nH]c3)cs2)CC1.
What is the InChIKey of 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol?
The InChIKey is XKSLPXUUIGIIKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2OS/c17-12-3-1-10(2-4-12)7-14-16-13(9-18-14)11-5-6-15-8-11/h5-6,8-10,12,15,17H,1-4,7H2.
What are the key properties of 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol?
4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol has a molecular weight of 262.38 g/mol, XLogP of 3.23, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methyl]cyclohexan-1-ol is sourced from PubChem (CID 116969164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).