About [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol
[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol (PubChem CID 116969329) has the molecular formula C10H15NOS
and a molecular weight of 197.30 g/mol. Its IUPAC name is [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol |
| PubChem CID | 116969329 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol |
| SMILES | CCc1csc(CC2(CO)CC2)n1 |
| InChI | InChI=1S/C10H15NOS/c1-2-8-6-13-9(11-8)5-10(7-12)3-4-10/h6,12H,2-5,7H2,1H3 |
| InChIKey | SDCLGDWRUHRVLC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol?
The IUPAC name of [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol (CID 116969329) is [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol.
What is the SMILES notation for [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol?
The canonical SMILES for [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol is CCc1csc(CC2(CO)CC2)n1.
What is the InChIKey of [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol?
The InChIKey is SDCLGDWRUHRVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NOS/c1-2-8-6-13-9(11-8)5-10(7-12)3-4-10/h6,12H,2-5,7H2,1H3.
What are the key properties of [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol?
[1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol has a molecular weight of 197.30 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-ethyl-1,3-thiazol-2-yl)methyl]cyclopropyl]methanol is sourced from PubChem (CID 116969329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).