About 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole
4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole (PubChem CID 116969914) has the molecular formula C10H12F3NOS
and a molecular weight of 251.27 g/mol. Its IUPAC name is 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole |
| PubChem CID | 116969914 |
| Molecular Formula | C10H12F3NOS |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole |
| SMILES | FC(F)(F)Cc1nc(C2CCOCC2)cs1 |
| InChI | InChI=1S/C10H12F3NOS/c11-10(12,13)5-9-14-8(6-16-9)7-1-3-15-4-2-7/h6-7H,1-5H2 |
| InChIKey | UOIYILNBNPQSEJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole?
The IUPAC name of 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole (CID 116969914) is 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole.
What is the SMILES notation for 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole?
The canonical SMILES for 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole is FC(F)(F)Cc1nc(C2CCOCC2)cs1.
What is the InChIKey of 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole?
The InChIKey is UOIYILNBNPQSEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3NOS/c11-10(12,13)5-9-14-8(6-16-9)7-1-3-15-4-2-7/h6-7H,1-5H2.
What are the key properties of 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole?
4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole has a molecular weight of 251.27 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxan-4-yl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole is sourced from PubChem (CID 116969914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).