C10H10N2OS — CID 116969991
2-(methoxymethyl)-4-pyridin-2-yl-1,3-thiazole (PubChem CID 116969991) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-(methoxymethyl)-4-pyridin-2-yl-1,3-thiazole.
| Compound Name | 2-(methoxymethyl)-4-pyridin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 116969991 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-(methoxymethyl)-4-pyridin-2-yl-1,3-thiazole |
| SMILES | COCc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C10H10N2OS/c1-13-6-10-12-9(7-14-10)8-4-2-3-5-11-8/h2-5,7H,6H2,1H3 |
| InChIKey | TUNDEEVWQGDVBD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |