C12H15N5 — CID 116970489
N-methyl-N'-(6-pyridin-4-ylpyridazin-3-yl)ethane-1,2-diamine (PubChem CID 116970489) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is N-methyl-N'-(6-pyridin-4-ylpyridazin-3-yl)ethane-1,2-diamine.
| Compound Name | N-methyl-N'-(6-pyridin-4-ylpyridazin-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116970489 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-methyl-N'-(6-pyridin-4-ylpyridazin-3-yl)ethane-1,2-diamine |
| SMILES | CNCCNc1ccc(-c2ccncc2)nn1 |
| InChI | InChI=1S/C12H15N5/c1-13-8-9-15-12-3-2-11(16-17-12)10-4-6-14-7-5-10/h2-7,13H,8-9H2,1H3,(H,15,17) |
| InChIKey | KZBKRGBSORORDZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|