C21H24N2O4S — CID 1169711
6,7-dimethyl-1-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-3H-thieno[2,3-e][1,4]diazepin-2-one (PubChem CID 1169711) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 6,7-dimethyl-1-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-3H-thieno[2,3-e][1,4]diazepin-2-one.
| Compound Name | 6,7-dimethyl-1-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-3H-thieno[2,3-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 1169711 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 6,7-dimethyl-1-prop-2-enyl-5-(3,4,5-trimethoxyphenyl)-3H-thieno[2,3-e][1,4]diazepin-2-one |
| SMILES | C=CCN1C(=O)CN=C(c2cc(OC)c(OC)c(OC)c2)c2c1sc(C)c2C |
| InChI | InChI=1S/C21H24N2O4S/c1-7-8-23-17(24)11-22-19(18-12(2)13(3)28-21(18)23)14-9-15(25-4)20(27-6)16(10-14)26-5/h7,9-10H,1,8,11H2,2-6H3 |
| InChIKey | UMHQYMKUCOJGTB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|