About bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine
bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine (PubChem CID 11697183) has the molecular formula C17H27BrClNO3
and a molecular weight of 408.76 g/mol. Its IUPAC name is bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine.
Molecular Properties
| Compound Name | bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine |
| PubChem CID | 11697183 |
| Molecular Formula | C17H27BrClNO3 |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine |
| SMILES | CC(C)CC(N(C)C)C1(c2ccc(Cl)cc2)CCC1.[O-][Br+2]([O-])O |
| InChI | InChI=1S/C17H26ClN.BrHO3/c1-13(2)12-16(19(3)4)17(10-5-11-17)14-6-8-15(18)9-7-14;2-1(3)4/h6-9,13,16H,5,10-12H2,1-4H3;2H |
| InChIKey | IEBJUBLJEZTPTM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine?
The IUPAC name of bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine (CID 11697183) is bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine.
What is the SMILES notation for bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine?
The canonical SMILES for bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine is CC(C)CC(N(C)C)C1(c2ccc(Cl)cc2)CCC1.[O-][Br+2]([O-])O.
What is the InChIKey of bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine?
The InChIKey is IEBJUBLJEZTPTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26ClN.BrHO3/c1-13(2)12-16(19(3)4)17(10-5-11-17)14-6-8-15(18)9-7-14;2-1(3)4/h6-9,13,16H,5,10-12H2,1-4H3;2H.
What are the key properties of bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine?
bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine has a molecular weight of 408.76 g/mol, XLogP of 1.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bromic acid;1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine is sourced from PubChem (CID 11697183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).