About 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile
3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile (PubChem CID 116971919) has the molecular formula C15H16N4
and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile.
Molecular Properties
| Compound Name | 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile |
| PubChem CID | 116971919 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile |
| SMILES | Cc1ccc(C)c(-c2ccc(NCCC#N)nn2)c1 |
| InChI | InChI=1S/C15H16N4/c1-11-4-5-12(2)13(10-11)14-6-7-15(19-18-14)17-9-3-8-16/h4-7,10H,3,9H2,1-2H3,(H,17,19) |
| InChIKey | MDHYMVBLRITHIH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile?
The IUPAC name of 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile (CID 116971919) is 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile.
What is the SMILES notation for 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile?
The canonical SMILES for 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile is Cc1ccc(C)c(-c2ccc(NCCC#N)nn2)c1.
What is the InChIKey of 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile?
The InChIKey is MDHYMVBLRITHIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4/c1-11-4-5-12(2)13(10-11)14-6-7-15(19-18-14)17-9-3-8-16/h4-7,10H,3,9H2,1-2H3,(H,17,19).
What are the key properties of 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile?
3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile has a molecular weight of 252.32 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[6-(2,5-dimethylphenyl)pyridazin-3-yl]amino]propanenitrile is sourced from PubChem (CID 116971919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).