C13H11F2N3O — CID 116972104
1-[[6-(2,5-difluorophenyl)pyridazin-3-yl]amino]propan-2-one (PubChem CID 116972104) has the molecular formula C13H11F2N3O and a molecular weight of 263.25 g/mol. Its IUPAC name is 1-[[6-(2,5-difluorophenyl)pyridazin-3-yl]amino]propan-2-one.
| Compound Name | 1-[[6-(2,5-difluorophenyl)pyridazin-3-yl]amino]propan-2-one |
|---|---|
| PubChem CID | 116972104 |
| Molecular Formula | C13H11F2N3O |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-[[6-(2,5-difluorophenyl)pyridazin-3-yl]amino]propan-2-one |
| SMILES | CC(=O)CNc1ccc(-c2cc(F)ccc2F)nn1 |
| InChI | InChI=1S/C13H11F2N3O/c1-8(19)7-16-13-5-4-12(17-18-13)10-6-9(14)2-3-11(10)15/h2-6H,7H2,1H3,(H,16,18) |
| InChIKey | LZWHRZBISJAYOQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |