About N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine
N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine (PubChem CID 116973259) has the molecular formula C14H16N6
and a molecular weight of 268.32 g/mol. Its IUPAC name is N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine |
| PubChem CID | 116973259 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)c1ccc(-c2ccc3nc[nH]c3c2)nn1 |
| InChI | InChI=1S/C14H16N6/c1-20(7-6-15)14-5-4-11(18-19-14)10-2-3-12-13(8-10)17-9-16-12/h2-5,8-9H,6-7,15H2,1H3,(H,16,17) |
| InChIKey | UGTATTNBJXZDSR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine?
The IUPAC name of N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine (CID 116973259) is N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine is CN(CCN)c1ccc(-c2ccc3nc[nH]c3c2)nn1.
What is the InChIKey of N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine?
The InChIKey is UGTATTNBJXZDSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N6/c1-20(7-6-15)14-5-4-11(18-19-14)10-2-3-12-13(8-10)17-9-16-12/h2-5,8-9H,6-7,15H2,1H3,(H,16,17).
What are the key properties of N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine?
N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine has a molecular weight of 268.32 g/mol, XLogP of 1.41, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[6-(3H-benzimidazol-5-yl)pyridazin-3-yl]-N'-methylethane-1,2-diamine is sourced from PubChem (CID 116973259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).