C22H23F2N3O3 — CID 11697334
[(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] 2-(dimethylamino)acetate (PubChem CID 11697334) has the molecular formula C22H23F2N3O3 and a molecular weight of 415.44 g/mol. Its IUPAC name is [(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] 2-(dimethylamino)acetate.
| Compound Name | [(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 11697334 |
| Molecular Formula | C22H23F2N3O3 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] 2-(dimethylamino)acetate |
| SMILES | Cc1nc2c3c(ccn2c1C)C(F)(F)[C@H](OC(=O)CN(C)C)[C@@H](c1ccccc1)O3 |
| InChI | InChI=1S/C22H23F2N3O3/c1-13-14(2)27-11-10-16-19(21(27)25-13)30-18(15-8-6-5-7-9-15)20(22(16,23)24)29-17(28)12-26(3)4/h5-11,18,20H,12H2,1-4H3/t18-,20-/m1/s1 |
| InChIKey | ZOCRDFAAOWYBTB-UYAOXDASSA-N |
| XLogP | 3.65 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |