About 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine
1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine (PubChem CID 116973386) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine |
| PubChem CID | 116973386 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine |
| SMILES | Cc1ccc(N(C)CC(C)(C)N)nn1 |
| InChI | InChI=1S/C10H18N4/c1-8-5-6-9(13-12-8)14(4)7-10(2,3)11/h5-6H,7,11H2,1-4H3 |
| InChIKey | FTXUWRWVKXJBHL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine?
The IUPAC name of 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine (CID 116973386) is 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine.
What is the SMILES notation for 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine?
The canonical SMILES for 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine is Cc1ccc(N(C)CC(C)(C)N)nn1.
What is the InChIKey of 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine?
The InChIKey is FTXUWRWVKXJBHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-8-5-6-9(13-12-8)14(4)7-10(2,3)11/h5-6H,7,11H2,1-4H3.
What are the key properties of 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine?
1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine has a molecular weight of 194.28 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-dimethyl-1-N-(6-methylpyridazin-3-yl)propane-1,2-diamine is sourced from PubChem (CID 116973386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).