C14H21N3O2 — CID 116973746
4-[(6-cyclopentylpyridazin-3-yl)-methylamino]butanoic acid (PubChem CID 116973746) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-[(6-cyclopentylpyridazin-3-yl)-methylamino]butanoic acid.
| Compound Name | 4-[(6-cyclopentylpyridazin-3-yl)-methylamino]butanoic acid |
|---|---|
| PubChem CID | 116973746 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 4-[(6-cyclopentylpyridazin-3-yl)-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)c1ccc(C2CCCC2)nn1 |
| InChI | InChI=1S/C14H21N3O2/c1-17(10-4-7-14(18)19)13-9-8-12(15-16-13)11-5-2-3-6-11/h8-9,11H,2-7,10H2,1H3,(H,18,19) |
| InChIKey | BJTIDWYQVVQECR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |