C14H14N4 — CID 116973781
[6-(2,4-dimethylphenyl)pyridazin-3-yl]-methylcyanamide (PubChem CID 116973781) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is [6-(2,4-dimethylphenyl)pyridazin-3-yl]-methylcyanamide.
| Compound Name | [6-(2,4-dimethylphenyl)pyridazin-3-yl]-methylcyanamide |
|---|---|
| PubChem CID | 116973781 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | [6-(2,4-dimethylphenyl)pyridazin-3-yl]-methylcyanamide |
| SMILES | Cc1ccc(-c2ccc(N(C)C#N)nn2)c(C)c1 |
| InChI | InChI=1S/C14H14N4/c1-10-4-5-12(11(2)8-10)13-6-7-14(17-16-13)18(3)9-15/h4-8H,1-3H3 |
| InChIKey | PDMXEEZXMYLVFY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|