About 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide
2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide (PubChem CID 11697436) has the molecular formula C22H17N3O2S2
and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide.
Molecular Properties
| Compound Name | 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide |
| PubChem CID | 11697436 |
| Molecular Formula | C22H17N3O2S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3ccsc23)cc1 |
| InChI | InChI=1S/C22H17N3O2S2/c26-20(14-15-4-2-1-3-5-15)25-22(28)24-16-6-8-17(9-7-16)27-19-10-12-23-18-11-13-29-21(18)19/h1-13H,14H2,(H2,24,25,26,28) |
| InChIKey | CCLISUOXZPWRGF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide?
The IUPAC name of 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide (CID 11697436) is 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide.
What is the SMILES notation for 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide?
The canonical SMILES for 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide is O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3ccsc23)cc1.
What is the InChIKey of 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide?
The InChIKey is CCLISUOXZPWRGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O2S2/c26-20(14-15-4-2-1-3-5-15)25-22(28)24-16-6-8-17(9-7-16)27-19-10-12-23-18-11-13-29-21(18)19/h1-13H,14H2,(H2,24,25,26,28).
What are the key properties of 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide?
2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide has a molecular weight of 419.53 g/mol, XLogP of 5.14, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-N-[(4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]acetamide is sourced from PubChem (CID 11697436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).