About N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine
N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine (PubChem CID 116974441) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine |
| PubChem CID | 116974441 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine |
| SMILES | CNCCCNc1ncc(C(C)C)cn1 |
| InChI | InChI=1S/C11H20N4/c1-9(2)10-7-14-11(15-8-10)13-6-4-5-12-3/h7-9,12H,4-6H2,1-3H3,(H,13,14,15) |
| InChIKey | NFXZEGXSCAMMDF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine?
The IUPAC name of N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine (CID 116974441) is N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine.
What is the SMILES notation for N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine?
The canonical SMILES for N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine is CNCCCNc1ncc(C(C)C)cn1.
What is the InChIKey of N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine?
The InChIKey is NFXZEGXSCAMMDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4/c1-9(2)10-7-14-11(15-8-10)13-6-4-5-12-3/h7-9,12H,4-6H2,1-3H3,(H,13,14,15).
What are the key properties of N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine?
N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine has a molecular weight of 208.31 g/mol, XLogP of 1.62, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-(5-propan-2-ylpyrimidin-2-yl)propane-1,3-diamine is sourced from PubChem (CID 116974441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).