C22H17FN4O2S — CID 11697446
3-[3-(15-fluoro-11-oxo-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-4-yl)piperidin-1-yl]-3-oxopropanenitrile (PubChem CID 11697446) has the molecular formula C22H17FN4O2S and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-[3-(15-fluoro-11-oxo-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-4-yl)piperidin-1-yl]-3-oxopropanenitrile.
| Compound Name | 3-[3-(15-fluoro-11-oxo-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-4-yl)piperidin-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 11697446 |
| Molecular Formula | C22H17FN4O2S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 3-[3-(15-fluoro-11-oxo-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-4-yl)piperidin-1-yl]-3-oxopropanenitrile |
| SMILES | N#CCC(=O)N1CCCC(c2nc3c4ccc(F)cc4c4c(=O)[nH]ccc4c3s2)C1 |
| InChI | InChI=1S/C22H17FN4O2S/c23-13-3-4-14-16(10-13)18-15(6-8-25-21(18)29)20-19(14)26-22(30-20)12-2-1-9-27(11-12)17(28)5-7-24/h3-4,6,8,10,12H,1-2,5,9,11H2,(H,25,29) |
| InChIKey | XBKGYLFQWVXMNZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|