About (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole
(2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole (PubChem CID 11697461) has the molecular formula C30H32N2
and a molecular weight of 420.60 g/mol. Its IUPAC name is (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole.
Molecular Properties
| Compound Name | (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole |
| PubChem CID | 11697461 |
| Molecular Formula | C30H32N2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole |
| SMILES | CCC1=C(CC)/C(=C/c2ccccc2)N=C1C1=N/C(=C\c2ccccc2)C(CC)=C1CC |
| InChI | InChI=1S/C30H32N2/c1-5-23-25(7-3)29(31-27(23)19-21-15-11-9-12-16-21)30-26(8-4)24(6-2)28(32-30)20-22-17-13-10-14-18-22/h9-20H,5-8H2,1-4H3/b27-19-,28-20- |
| InChIKey | CHXXGCCQDVWLQJ-RSSRHXQMSA-N |
| XLogP | 8.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole?
The IUPAC name of (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole (CID 11697461) is (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole.
What is the SMILES notation for (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole?
The canonical SMILES for (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole is CCC1=C(CC)/C(=C/c2ccccc2)N=C1C1=N/C(=C\c2ccccc2)C(CC)=C1CC.
What is the InChIKey of (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole?
The InChIKey is CHXXGCCQDVWLQJ-RSSRHXQMSA-N. The full InChI is InChI=1S/C30H32N2/c1-5-23-25(7-3)29(31-27(23)19-21-15-11-9-12-16-21)30-26(8-4)24(6-2)28(32-30)20-22-17-13-10-14-18-22/h9-20H,5-8H2,1-4H3/b27-19-,28-20-.
What are the key properties of (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole?
(2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole has a molecular weight of 420.60 g/mol, XLogP of 8.21, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-benzylidene-5-[(5Z)-5-benzylidene-3,4-diethylpyrrol-2-yl]-3,4-diethylpyrrole is sourced from PubChem (CID 11697461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).