C15H18N4 — CID 116974648
N-(azetidin-3-yl)-5-(3,4-dimethylphenyl)pyrimidin-2-amine (PubChem CID 116974648) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-(azetidin-3-yl)-5-(3,4-dimethylphenyl)pyrimidin-2-amine.
| Compound Name | N-(azetidin-3-yl)-5-(3,4-dimethylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 116974648 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-(azetidin-3-yl)-5-(3,4-dimethylphenyl)pyrimidin-2-amine |
| SMILES | Cc1ccc(-c2cnc(NC3CNC3)nc2)cc1C |
| InChI | InChI=1S/C15H18N4/c1-10-3-4-12(5-11(10)2)13-6-17-15(18-7-13)19-14-8-16-9-14/h3-7,14,16H,8-9H2,1-2H3,(H,17,18,19) |
| InChIKey | LIGYFAJVIWQBOM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |