C12H12BrN3S — CID 116975393
2-[[5-(2-bromophenyl)pyrimidin-2-yl]amino]ethanethiol (PubChem CID 116975393) has the molecular formula C12H12BrN3S and a molecular weight of 310.22 g/mol. Its IUPAC name is 2-[[5-(2-bromophenyl)pyrimidin-2-yl]amino]ethanethiol.
| Compound Name | 2-[[5-(2-bromophenyl)pyrimidin-2-yl]amino]ethanethiol |
|---|---|
| PubChem CID | 116975393 |
| Molecular Formula | C12H12BrN3S |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 2-[[5-(2-bromophenyl)pyrimidin-2-yl]amino]ethanethiol |
| SMILES | SCCNc1ncc(-c2ccccc2Br)cn1 |
| InChI | InChI=1S/C12H12BrN3S/c13-11-4-2-1-3-10(11)9-7-15-12(16-8-9)14-5-6-17/h1-4,7-8,17H,5-6H2,(H,14,15,16) |
| InChIKey | QHKNCICSNARLDC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|