C13H23N5 — CID 116976024
N-[(1-methylpiperazin-2-yl)methyl]-5-propylpyrimidin-2-amine (PubChem CID 116976024) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is N-[(1-methylpiperazin-2-yl)methyl]-5-propylpyrimidin-2-amine.
| Compound Name | N-[(1-methylpiperazin-2-yl)methyl]-5-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 116976024 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | N-[(1-methylpiperazin-2-yl)methyl]-5-propylpyrimidin-2-amine |
| SMILES | CCCc1cnc(NCC2CNCCN2C)nc1 |
| InChI | InChI=1S/C13H23N5/c1-3-4-11-7-15-13(16-8-11)17-10-12-9-14-5-6-18(12)2/h7-8,12,14H,3-6,9-10H2,1-2H3,(H,15,16,17) |
| InChIKey | WFTYOCUDTXAVRA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |