C15H18N4 — CID 116976426
2-(3-methylpiperazin-1-yl)-5-phenylpyrimidine (PubChem CID 116976426) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-(3-methylpiperazin-1-yl)-5-phenylpyrimidine.
| Compound Name | 2-(3-methylpiperazin-1-yl)-5-phenylpyrimidine |
|---|---|
| PubChem CID | 116976426 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-(3-methylpiperazin-1-yl)-5-phenylpyrimidine |
| SMILES | CC1CN(c2ncc(-c3ccccc3)cn2)CCN1 |
| InChI | InChI=1S/C15H18N4/c1-12-11-19(8-7-16-12)15-17-9-14(10-18-15)13-5-3-2-4-6-13/h2-6,9-10,12,16H,7-8,11H2,1H3 |
| InChIKey | FASNRJJMZGJEHE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |