C16H16N4 — CID 116977818
methyl-[5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrimidin-2-yl]cyanamide (PubChem CID 116977818) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is methyl-[5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrimidin-2-yl]cyanamide.
| Compound Name | methyl-[5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 116977818 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | methyl-[5-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrimidin-2-yl]cyanamide |
| SMILES | CN(C#N)c1ncc(-c2ccc3c(c2)CCCC3)cn1 |
| InChI | InChI=1S/C16H16N4/c1-20(11-17)16-18-9-15(10-19-16)14-7-6-12-4-2-3-5-13(12)8-14/h6-10H,2-5H2,1H3 |
| InChIKey | VYXHWTLDJPOGFK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|