About methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide
methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide (PubChem CID 116977843) has the molecular formula C16H18N4
and a molecular weight of 266.35 g/mol. Its IUPAC name is methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide.
Molecular Properties
| Compound Name | methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide |
| PubChem CID | 116977843 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide |
| SMILES | Cc1cc(C)c(C)c(-c2cnc(N(C)C#N)nc2)c1C |
| InChI | InChI=1S/C16H18N4/c1-10-6-11(2)13(4)15(12(10)3)14-7-18-16(19-8-14)20(5)9-17/h6-8H,1-5H3 |
| InChIKey | NEZRBBQATDBSJE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide?
The IUPAC name of methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide (CID 116977843) is methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide.
What is the SMILES notation for methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide?
The canonical SMILES for methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide is Cc1cc(C)c(C)c(-c2cnc(N(C)C#N)nc2)c1C.
What is the InChIKey of methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide?
The InChIKey is NEZRBBQATDBSJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4/c1-10-6-11(2)13(4)15(12(10)3)14-7-18-16(19-8-14)20(5)9-17/h6-8H,1-5H3.
What are the key properties of methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide?
methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide has a molecular weight of 266.35 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[5-(2,3,5,6-tetramethylphenyl)pyrimidin-2-yl]cyanamide is sourced from PubChem (CID 116977843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).