C25H40O6 — CID 11697830
ethyl 2-[(3S,8R,11R,12R,13S,17R)-5-hydroxy-8,11,15,15-tetramethyl-12-propan-2-yl-4,14,16-trioxatetracyclo[9.6.0.03,8.013,17]heptadec-1-en-5-yl]acetate (PubChem CID 11697830) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is ethyl 2-[(3S,8R,11R,12R,13S,17R)-5-hydroxy-8,11,15,15-tetramethyl-12-propan-2-yl-4,14,16-trioxatetracyclo[9.6.0.03,8.013,17]heptadec-1-en-5-yl]acetate.
| Compound Name | ethyl 2-[(3S,8R,11R,12R,13S,17R)-5-hydroxy-8,11,15,15-tetramethyl-12-propan-2-yl-4,14,16-trioxatetracyclo[9.6.0.03,8.013,17]heptadec-1-en-5-yl]acetate |
|---|---|
| PubChem CID | 11697830 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | ethyl 2-[(3S,8R,11R,12R,13S,17R)-5-hydroxy-8,11,15,15-tetramethyl-12-propan-2-yl-4,14,16-trioxatetracyclo[9.6.0.03,8.013,17]heptadec-1-en-5-yl]acetate |
| SMILES | CCOC(=O)CC1(O)CC[C@@]2(C)CC[C@@]3(C)C(=C[C@@H]2O1)[C@H]1OC(C)(C)O[C@H]1[C@@H]3C(C)C |
| InChI | InChI=1S/C25H40O6/c1-8-28-18(26)14-25(27)12-10-23(6)9-11-24(7)16(13-17(23)29-25)20-21(19(24)15(2)3)31-22(4,5)30-20/h13,15,17,19-21,27H,8-12,14H2,1-7H3/t17-,19-,20+,21-,23+,24-,25?/m0/s1 |
| InChIKey | JWAVYCDOGYUDON-BXEXAYHQSA-N |
| XLogP | 4.35 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|