About 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one
1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one (PubChem CID 116978407) has the molecular formula C15H23N3O
and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one |
| PubChem CID | 116978407 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one |
| SMILES | Cc1cc(C)c(C2CN(CC(C)N)C(=O)N2)cc1C |
| InChI | InChI=1S/C15H23N3O/c1-9-5-11(3)13(6-10(9)2)14-8-18(7-12(4)16)15(19)17-14/h5-6,12,14H,7-8,16H2,1-4H3,(H,17,19) |
| InChIKey | FOIZONVXQRWCRG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one?
The IUPAC name of 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one (CID 116978407) is 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one.
What is the SMILES notation for 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one?
The canonical SMILES for 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one is Cc1cc(C)c(C2CN(CC(C)N)C(=O)N2)cc1C.
What is the InChIKey of 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one?
The InChIKey is FOIZONVXQRWCRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O/c1-9-5-11(3)13(6-10(9)2)14-8-18(7-12(4)16)15(19)17-14/h5-6,12,14H,7-8,16H2,1-4H3,(H,17,19).
What are the key properties of 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one?
1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one has a molecular weight of 261.37 g/mol, XLogP of 2.03, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminopropyl)-4-(2,4,5-trimethylphenyl)imidazolidin-2-one is sourced from PubChem (CID 116978407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).