C13H14N4O — CID 116979248
1-(4-aminophenyl)-4-(1H-pyrrol-2-yl)imidazolidin-2-one (PubChem CID 116979248) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-(4-aminophenyl)-4-(1H-pyrrol-2-yl)imidazolidin-2-one.
| Compound Name | 1-(4-aminophenyl)-4-(1H-pyrrol-2-yl)imidazolidin-2-one |
|---|---|
| PubChem CID | 116979248 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(4-aminophenyl)-4-(1H-pyrrol-2-yl)imidazolidin-2-one |
| SMILES | Nc1ccc(N2CC(c3ccc[nH]3)NC2=O)cc1 |
| InChI | InChI=1S/C13H14N4O/c14-9-3-5-10(6-4-9)17-8-12(16-13(17)18)11-2-1-7-15-11/h1-7,12,15H,8,14H2,(H,16,18) |
| InChIKey | JTUFGCKQTXPTLZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|