C17H26ClF3O4Si2 — CID 11697951
methyl 2-[(3-chlorophenyl)-trimethylsilyloxymethyl]-3,3,3-trifluoro-2-trimethylsilyloxypropanoate (PubChem CID 11697951) has the molecular formula C17H26ClF3O4Si2 and a molecular weight of 443.01 g/mol. Its IUPAC name is methyl 2-[(3-chlorophenyl)-trimethylsilyloxymethyl]-3,3,3-trifluoro-2-trimethylsilyloxypropanoate.
| Compound Name | methyl 2-[(3-chlorophenyl)-trimethylsilyloxymethyl]-3,3,3-trifluoro-2-trimethylsilyloxypropanoate |
|---|---|
| PubChem CID | 11697951 |
| Molecular Formula | C17H26ClF3O4Si2 |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | methyl 2-[(3-chlorophenyl)-trimethylsilyloxymethyl]-3,3,3-trifluoro-2-trimethylsilyloxypropanoate |
| SMILES | COC(=O)C(O[Si](C)(C)C)(C(O[Si](C)(C)C)c1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C17H26ClF3O4Si2/c1-23-15(22)16(17(19,20)21,25-27(5,6)7)14(24-26(2,3)4)12-9-8-10-13(18)11-12/h8-11,14H,1-7H3 |
| InChIKey | MADZCOKSKPETHC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|