About ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate
ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate (PubChem CID 11697974) has the molecular formula C22H28N4O6
and a molecular weight of 444.49 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate |
| PubChem CID | 11697974 |
| Molecular Formula | C22H28N4O6 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate |
| SMILES | CCCn1c(/C=C/c2ccc(NCC(=O)OCC)cc2)c([N+](=O)[O-])c(=O)n(CCC)c1=O |
| InChI | InChI=1S/C22H28N4O6/c1-4-13-24-18(20(26(30)31)21(28)25(14-5-2)22(24)29)12-9-16-7-10-17(11-8-16)23-15-19(27)32-6-3/h7-12,23H,4-6,13-15H2,1-3H3/b12-9+ |
| InChIKey | KHROBKYSWOIUHQ-FMIVXFBMSA-N |
| XLogP | 2.88 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate?
The IUPAC name of ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate (CID 11697974) is ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate.
What is the SMILES notation for ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate?
The canonical SMILES for ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate is CCCn1c(/C=C/c2ccc(NCC(=O)OCC)cc2)c([N+](=O)[O-])c(=O)n(CCC)c1=O.
What is the InChIKey of ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate?
The InChIKey is KHROBKYSWOIUHQ-FMIVXFBMSA-N. The full InChI is InChI=1S/C22H28N4O6/c1-4-13-24-18(20(26(30)31)21(28)25(14-5-2)22(24)29)12-9-16-7-10-17(11-8-16)23-15-19(27)32-6-3/h7-12,23H,4-6,13-15H2,1-3H3/b12-9+.
What are the key properties of ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate?
ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate has a molecular weight of 444.49 g/mol, XLogP of 2.88, 11 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-[(E)-2-(5-nitro-2,6-dioxo-1,3-dipropylpyrimidin-4-yl)ethenyl]anilino]acetate is sourced from PubChem (CID 11697974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).