C11H13BrN2OS — CID 116979888
4-(2-bromophenyl)-1-(2-sulfanylethyl)imidazolidin-2-one (PubChem CID 116979888) has the molecular formula C11H13BrN2OS and a molecular weight of 301.21 g/mol. Its IUPAC name is 4-(2-bromophenyl)-1-(2-sulfanylethyl)imidazolidin-2-one.
| Compound Name | 4-(2-bromophenyl)-1-(2-sulfanylethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 116979888 |
| Molecular Formula | C11H13BrN2OS |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 4-(2-bromophenyl)-1-(2-sulfanylethyl)imidazolidin-2-one |
| SMILES | O=C1NC(c2ccccc2Br)CN1CCS |
| InChI | InChI=1S/C11H13BrN2OS/c12-9-4-2-1-3-8(9)10-7-14(5-6-16)11(15)13-10/h1-4,10,16H,5-7H2,(H,13,15) |
| InChIKey | WQSUFAINWKWMQE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|