C12H15BrN2OS — CID 116982256
4-(3-bromophenyl)-3-methyl-1-(2-sulfanylethyl)imidazolidin-2-one (PubChem CID 116982256) has the molecular formula C12H15BrN2OS and a molecular weight of 315.24 g/mol. Its IUPAC name is 4-(3-bromophenyl)-3-methyl-1-(2-sulfanylethyl)imidazolidin-2-one.
| Compound Name | 4-(3-bromophenyl)-3-methyl-1-(2-sulfanylethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 116982256 |
| Molecular Formula | C12H15BrN2OS |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 4-(3-bromophenyl)-3-methyl-1-(2-sulfanylethyl)imidazolidin-2-one |
| SMILES | CN1C(=O)N(CCS)CC1c1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrN2OS/c1-14-11(8-15(5-6-17)12(14)16)9-3-2-4-10(13)7-9/h2-4,7,11,17H,5-6,8H2,1H3 |
| InChIKey | QDLRLDKNZUFKEO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|