About 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one
1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one (PubChem CID 116983036) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one |
| PubChem CID | 116983036 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one |
| SMILES | CCN1CC(c2cc(C)c(OC)cc2C)N(C)C1=O |
| InChI | InChI=1S/C15H22N2O2/c1-6-17-9-13(16(4)15(17)18)12-7-11(3)14(19-5)8-10(12)2/h7-8,13H,6,9H2,1-5H3 |
| InChIKey | NWURGGKDEFDHHQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one?
The IUPAC name of 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one (CID 116983036) is 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one.
What is the SMILES notation for 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one?
The canonical SMILES for 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one is CCN1CC(c2cc(C)c(OC)cc2C)N(C)C1=O.
What is the InChIKey of 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one?
The InChIKey is NWURGGKDEFDHHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-6-17-9-13(16(4)15(17)18)12-7-11(3)14(19-5)8-10(12)2/h7-8,13H,6,9H2,1-5H3.
What are the key properties of 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one?
1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one has a molecular weight of 262.35 g/mol, XLogP of 2.74, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(4-methoxy-2,5-dimethylphenyl)-3-methylimidazolidin-2-one is sourced from PubChem (CID 116983036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).