C13H14BrN — CID 116983494
6-bromo-2,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene (PubChem CID 116983494) has the molecular formula C13H14BrN and a molecular weight of 264.17 g/mol. Its IUPAC name is 6-bromo-2,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene.
| Compound Name | 6-bromo-2,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 116983494 |
| Molecular Formula | C13H14BrN |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 6-bromo-2,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
| SMILES | Cc1c(C)n2c3c(cc(Br)cc13)CCC2 |
| InChI | InChI=1S/C13H14BrN/c1-8-9(2)15-5-3-4-10-6-11(14)7-12(8)13(10)15/h6-7H,3-5H2,1-2H3 |
| InChIKey | NTJWHHBSSVAFGQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|