C13H14BrNS — CID 116983551
2-(3-bromo-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl)ethanethiol (PubChem CID 116983551) has the molecular formula C13H14BrNS and a molecular weight of 296.23 g/mol. Its IUPAC name is 2-(3-bromo-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl)ethanethiol.
| Compound Name | 2-(3-bromo-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl)ethanethiol |
|---|---|
| PubChem CID | 116983551 |
| Molecular Formula | C13H14BrNS |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 2-(3-bromo-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl)ethanethiol |
| SMILES | SCCc1cc2c3c(c1)c(Br)cn3CCC2 |
| InChI | InChI=1S/C13H14BrNS/c14-12-8-15-4-1-2-10-6-9(3-5-16)7-11(12)13(10)15/h6-8,16H,1-5H2 |
| InChIKey | JYODVFKJLLWNLO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 4.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|