C10H12F3N3O — CID 116984684
1-[3-(aminomethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 116984684) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[3-(aminomethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 116984684 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 1-[3-(aminomethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | NCc1nc(C(=O)C(F)(F)F)c2n1CCCC2 |
| InChI | InChI=1S/C10H12F3N3O/c11-10(12,13)9(17)8-6-3-1-2-4-16(6)7(5-14)15-8/h1-5,14H2 |
| InChIKey | FMNVHUZYYYNVLF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |