C11H14F3N3O — CID 116984685
2,2,2-trifluoro-1-[3-(methylaminomethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]ethanone (PubChem CID 116984685) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[3-(methylaminomethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[3-(methylaminomethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 116984685 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2,2,2-trifluoro-1-[3-(methylaminomethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]ethanone |
| SMILES | CNCc1nc(C(=O)C(F)(F)F)c2n1CCCC2 |
| InChI | InChI=1S/C11H14F3N3O/c1-15-6-8-16-9(10(18)11(12,13)14)7-4-2-3-5-17(7)8/h15H,2-6H2,1H3 |
| InChIKey | ACGODMPKHBUYLF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |