C11H14F3N3O — CID 116984686
1-[3-(1-aminoethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 116984686) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[3-(1-aminoethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 116984686 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-[3-(1-aminoethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | CC(N)c1nc(C(=O)C(F)(F)F)c2n1CCCC2 |
| InChI | InChI=1S/C11H14F3N3O/c1-6(15)10-16-8(9(18)11(12,13)14)7-4-2-3-5-17(7)10/h6H,2-5,15H2,1H3 |
| InChIKey | ZJWPGMGMHHTAJX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |