C10H10ClF3N2O — CID 116984688
1-[3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 116984688) has the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. Its IUPAC name is 1-[3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 116984688 |
| Molecular Formula | C10H10ClF3N2O |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-[3-(chloromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1nc(CCl)n2c1CCCC2)C(F)(F)F |
| InChI | InChI=1S/C10H10ClF3N2O/c11-5-7-15-8(9(17)10(12,13)14)6-3-1-2-4-16(6)7/h1-5H2 |
| InChIKey | QGZBDFHTQCQPGK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|