C9H10F3N3O — CID 116984694
1-(3-amino-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl)-2,2,2-trifluoroethanone (PubChem CID 116984694) has the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. Its IUPAC name is 1-(3-amino-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3-amino-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 116984694 |
| Molecular Formula | C9H10F3N3O |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1-(3-amino-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl)-2,2,2-trifluoroethanone |
| SMILES | Nc1nc(C(=O)C(F)(F)F)c2n1CCCC2 |
| InChI | InChI=1S/C9H10F3N3O/c10-9(11,12)7(16)6-5-3-1-2-4-15(5)8(13)14-6/h1-4H2,(H2,13,14) |
| InChIKey | SLEMKVYCJCHUSB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |