C14H12BrN3 — CID 116984844
4-(1-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylaniline (PubChem CID 116984844) has the molecular formula C14H12BrN3 and a molecular weight of 302.18 g/mol. Its IUPAC name is 4-(1-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylaniline.
| Compound Name | 4-(1-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylaniline |
|---|---|
| PubChem CID | 116984844 |
| Molecular Formula | C14H12BrN3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 4-(1-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylaniline |
| SMILES | CNc1ccc(-c2nc(Br)c3ccccn23)cc1 |
| InChI | InChI=1S/C14H12BrN3/c1-16-11-7-5-10(6-8-11)14-17-13(15)12-4-2-3-9-18(12)14/h2-9,16H,1H3 |
| InChIKey | OGRRKNJXIMODDT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |